Search Results

Search found 46973 results on 1879 pages for 'return path'.

Page 118/1879 | < Previous Page | 114 115 116 117 118 119 120 121 122 123 124 125  | Next Page >

  • What should I look into to find a career path?

    - by PetrakovichJ
    I am finishing up my bachelor's degree in computer science and am feeling somewhat burnt out in the field. I enjoy solving problems, programming, and using computers to find said solutions, but I feel that I never really concentrated on anything in particular and so I don't have any specialties or a path in technology to follow. I feel like a 'generic programmer' with nothing special to offer. My question is, where can I look to find this niche? I have interest in the environment, nature, sustainability, and other similar things. Is there something in these areas in particular where specialists are needed? My question is somewhat vague but where did you "find your niche"?

    Read the article

  • ActiveRecord + CodeIgniter - Return single value from query, not in array form.

    - by txmail
    Say you construct an activerecord query that will always just return a single value, how do you just address that single value instead of getting an array in return? For instance I am using an ActiveRecord query to return the SUM of a single column, it will only return this one single SUM, instead of having to parse the array is there a way to assign the value as a function return equal to that value instead of getting an array?

    Read the article

  • If two separate PATH directories contain a same-named executable, how does Windows choose?

    - by Coldblackice
    I'm in the process of upgrading PEAR (PHP) on my system. The upgrade script is encouraging me to add "..\PHP\PEAR" to my PATH so that I can use "pear.bat". However, I already am able to use pear.bat. Looking in my PATH, I see that I don't have any PEAR directories, only my PHP directory. Opening my PHP directory, I see that there's a "pear.bat" in the base. But there's also a pear.bat in the PEAR subfolder of PHP. I'm wondering if I borked a PEAR install. I digress. So if I leave ..\PHP in my path, but also add ..\PHP\PEAR -- both of which have a "pear.bat" in them -- which one will Windows "choose"? How does Windows decide?

    Read the article

  • Why do I get duplicated entries in my $PATH?

    - by reprogrammer
    I'm using Ubuntu 9.10 (karmic). And, my ~/.pam_environment looks like the following. PATH DEFAULT=${PATH}:~/Adobe/Reader9/bin:~/texlive/2009/bin/x86_64-linux GIT_EDITOR DEFAULT=vim MANPATH DEFAULT=${MANPATH}:~/texlive/2009/texmf/doc/man INFOPATH DEFAULT=${INFOPATH}:~/texlive/2009/texmf/doc/info But, echo $PATH returns me duplicated entries as the following. /usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/games:~/apps/Adobe/Reader9/bin:~/apps/texlive/2009/bin/x86_64-linux:~/apps/Adobe/Reader9/bin:~/apps/texlive/2009/bin/x86_64-linux I've tried replacing DEFAULT by OVERRIDE in my ~/.pam_environment file. But, that didn't help. Does any one know what's wrong with my ~/.pam_environment?

    Read the article

  • log4j-1.2.8.jar gets deleted from the path when a Webservice is created from Eclipse

    - by Seema
    When I try to create a Webservice from Eclipse, the log4j-1.2.8.jar which is configured in the project's build path just gets deleted, and when I try to invoke the Webservice it gives error as below: 2014-06-05 11:47:48,742 ERROR ServiceRequester:55 - RemoteException 2014-06-05 11:47:48,742 ERROR ServiceRequester:56 - ------ AxisFault faultCode: {http://schemas.xmlsoap.org/soap/envelope/}Server.generalException faultSubcode: faultString: java.lang.NoClassDefFoundError: org/apache/log4j/Logger; nested ex ception is: java.lang.NoClassDefFoundError: org/apache/log4j/Logger faultActor: faultNode: faultDetail: {http://xml.apache.org/axis/}hostname:INPUSCPC07719 java.lang.NoClassDefFoundError: org/apache/log4j/Logger; nested exception is: java.lang.NoClassDefFoundError: org/apache/log4j/Logger We also tried to place this jar to a different path than where the project is located, but it still delete this jar from that path too. Can anyone help in this?

    Read the article

  • How do I perform commands in another folder, without repeating the folder path?

    - by Valter Henrique
    Is there a clever way to do copy and move operations or a command to duplicate a file, without having to do a cd, then mv after, at the same folder? For example, I have to run the following: mv /folder1/folder2/folder3/file.txt /folder1/folder2/folder3/file-2013.txt Note that the directory to where I'm moving the file is the same, but I have to put the whole path again and sometimes it gets annoying. I'm curious to know if there's another way to do that without having to put the whole path again, because the operation would be done in the same path.

    Read the article

  • Migrating to ssh key authentication; implications of adding sbin's to users $PATH

    - by ancillary
    I'm in the process of migrating to key's for authentication on my CentOS boxes. I have it all set up and working, but was a bit taken aback when I noticed service (and other things) didn't work the way I was accustomed to. Even after su'ing to root, still had to call the full path for it to work (which I assume to be expected/normal behavior). I also assume this is because there are different $PATH's for root (what I was using and am used to) and the newly created, key-using user. Specifically, I noticed the sbin's of the world missing from the user path. If I were to add those paths (/sbin/,/usr/sbin/,/usr/local/sbin) to a profile.d .sh script for this new key-loving user, would: I be opening up the system in ways I shouldn't be? I be doing something I needn't do save for reasons of laziness? I create other potential problems? Thanks.

    Read the article

  • Finding the length of files and file path of directory structure in a Linux file system.

    - by Robert Nickens
    I have a problem on a Linux OS running a version of SMB where if the absolute path to a directory within a Shared Folder is greater than 1024 bytes and the filename component is greater than 256 bytes the SMB service crashes and locks out all other services for network access like, SSH and FTP rendering the machine mute. To keep the system for crashing I’ve temporarily moved a group of folders where I think the problem path may be located outside of Shared Folder. I need to find the file and file path that exceeded this limitation and rename them or remove them allowing me to return a bulk of the files to the Shared Folder. I’ve tried the find and grep commands without success. Is there a chain of commands or script that I can use to hunt down the offending files and directory? Please advise.

    Read the article

  • ServerA can't access ServerB through UNC path. How do I troubleshoot?

    - by cparker4486
    All my servers are in the same domain on the same network. ServerA cannot access ServerB through UNC path. However DNS resolves correctly for ServerB from ServerA. For example "ping ServerB" works as expected. ServerB can reach ServerA through UNC path without any problem. Likewise all other servers and clients can reach ServerB through UNC path without any problem. The software firewall on ServerB is not turned on and there are no hardware firewalls getting in the way. This makes no sense and I don't know how to troubleshoot it. Nothing shows up in the event logs of ServerA and ServerB has one event (repeatedly): Event ID: 3019, Source: MrxSmb. ServerA is Server 2008 R2. ServerB is Server 2003 R2. I have other 2008 R2 servers that connect without any problem.

    Read the article

  • How to alter my mac os $PATH variable so that I can run the latest php version? [closed]

    - by skiabox
    Possible Duplicate: What are PATH and other environment variables, and how can I set or use them? I've just followed this article (http://mac.tutsplus.com/tutorials/server/upgrading-the-native-php-installation-on-os-x-mountain-lion/) to update my php installation using HomeBrew. The latest php version is indeed installed in /usr/local/bin The problem is that my $PATH variable is the following (doing an echo $PATH reveals it) : /usr/local/mysql/bin:/usr/bin:/bin:/usr/sbin:/sbin:/usr/local/bin:/opt/X11/bin ...so the old version of php (that comes with mountain lion) always run first Any ideas on how to solve this? Thank you.

    Read the article

  • How to avoid specifying full path in sudoers file?

    - by s g
    I am trying to add a NOPASSWD entry for sudotest.sh (or any script/binary that requires sudo) in my /etc/sudoers file (on Ubuntu 12.04 LTS server), but in order to make it work, I must specify the full path. The following entry works just fine: %jenkins ALL=(ALL)NOPASSWD:/home/vts_share/test/sudotest.sh The problem is that the script might move to a different directory. This seems like a great chance to use the * wildcard in the path (i.e. /*/sudotest.sh) so that my script could be in any directory but the manual states that wildcards will not match the / character when used in a path. I've confirmed that it doesn't work. I know that I can use the word ALL in place of my script, but this means there is no password prompt for any commands which seems unsafe. How do I solve this?

    Read the article

  • How can unrealscript halt event handler execution after an arbitrary number of lines with no return or error?

    - by Dan Cowell
    I have created a class that extends TcpLink and is instantiated in a custom Kismet Sequence Action. It is being instantiated correctly and is making the GET HTTP request that I need it to (I have checked my access log in apache) and Apache is responding to the request with the appropriate content. The problem I have is that I'm using the event receive mode and it appears that somehow the handler for the Opened event is halted after a specific number of lines of code have executed. Here is my code for the Opened event: event Opened() { // A connection was established WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] event opened"); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Sending simple HTTP query"); //The HTTP GET request //char(13) and char(10) are carrage returns and new lines requesttext = "userId="$userId$"&apartmentId="$apartmentId; SendText("GET /"$path$"?"$requesttext$" HTTP/1.0"); SendText(chr(13)$chr(10)); SendText("Host: "$TargetHost); SendText(chr(13)$chr(10)); SendText("Connection: Close"); SendText(chr(13)$chr(10)$chr(13)$chr(10)); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Sent request: "$requesttext); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] end HTTP query"); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] LinkState: "$LinkState); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] LinkMode: "$LinkMode); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] ReceiveMode: "$ReceiveMode); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Error: "$string(GetLastError())); } As you can see, a number of the Broadcast calls have been commented out. Initially, only the lines up to the Broadcast containing "[DNomad_TcpLinkClient] Sent request: " were being executed and none of the Broadcasts were commented out. After commenting out that line, the next Broadcast was successful and so on and so forth. As a test, I commented out the very first Broadcast to see if the connection closing had any effect: // A connection was established //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] event opened"); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Sending simple HTTP query"); Upon doing that, an additional Broadcast at the end of the function executed. Thus the inference that there is an upper limit to the number of lines executed. Additionally, my ReceivedText handler is never called, despite Apache returning the correct HTTP 200 response with a body. My working hypothesis is that somehow after the Sequence Action finishes executing the garbage collector cleans up the TcpLinkClient instance. My biggest source of confusion with that is how on earth it does it during the execution of an event handler. Has anyone ever seen anything like this before? My full TcpLinkClient class is below: /* * TcpLinkClient based on an example usage of the TcpLink class by Michiel 'elmuerte' Hendriks for Epic Games, Inc. * */ class DNomad_TcpLinkClient extends TcpLink; var PlayerController PC; var string TargetHost; var int TargetPort; var string path; var string requesttext; var string userId; var string apartmentId; var string statusCode; var string responseData; event PostBeginPlay() { super.PostBeginPlay(); } function DoTcpLinkRequest(string uid, string id) //removes having to send a host { userId = uid; apartmentId = id; Resolve(targethost); } function string GetStatus() { return statusCode; } event Resolved( IpAddr Addr ) { // The hostname was resolved succefully WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] "$TargetHost$" resolved to "$ IpAddrToString(Addr)); // Make sure the correct remote port is set, resolving doesn't set // the port value of the IpAddr structure Addr.Port = TargetPort; //dont comment out this log because it rungs the function bindport WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Bound to port: "$ BindPort() ); if (!Open(Addr)) { WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Open failed"); } } event ResolveFailed() { WorldInfo.Game.Broadcast(self, "[TcpLinkClient] Unable to resolve "$TargetHost); // You could retry resolving here if you have an alternative // remote host. //send failed message to scaleform UI //JunHud(JunPlayerController(PC).myHUD).JunMovie.CallSetHTML("Failed"); } event Opened() { // A connection was established //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] event opened"); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Sending simple HTTP query"); //The HTTP GET request //char(13) and char(10) are carrage returns and new lines requesttext = "userId="$userId$"&apartmentId="$apartmentId; SendText("GET /"$path$"?"$requesttext$" HTTP/1.0"); SendText(chr(13)$chr(10)); SendText("Host: "$TargetHost); SendText(chr(13)$chr(10)); SendText("Connection: Close"); SendText(chr(13)$chr(10)$chr(13)$chr(10)); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Sent request: "$requesttext); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] end HTTP query"); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] LinkState: "$LinkState); //WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] LinkMode: "$LinkMode); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] ReceiveMode: "$ReceiveMode); WorldInfo.Game.Broadcast(self, "[DNomad_TcpLinkClient] Error: "$string(GetLastError())); } event Closed() { // In this case the remote client should have automatically closed // the connection, because we requested it in the HTTP request. WorldInfo.Game.Broadcast(self, "Connection closed."); // After the connection was closed we could establish a new // connection using the same TcpLink instance. } event ReceivedText( string Text ) { WorldInfo.Game.Broadcast(self, "Received Text: "$Text); //we dont want the header info, so we split the string after two new lines Text = Split(Text, chr(13)$chr(10)$chr(13)$chr(10), true); WorldInfo.Game.Broadcast(self, "Split Text: "$Text); statusCode = Text; } event ReceivedLine( string Line ) { WorldInfo.Game.Broadcast(self, "Received Line: "$Line); } event ReceivedBinary( int Count, byte B[255] ) { WorldInfo.Game.Broadcast(self, "Received Binary of length: "$Count); } defaultproperties { TargetHost="127.0.0.1" TargetPort=80 //default for HTTP LinkMode=MODE_Text ReceiveMode=RMODE_Event path = "dnomad/datafeed.php" userId = "0"; apartmentId = "0"; statusCode = ""; send = false; }

    Read the article

  • Where can these be posted besides the Python Cookbook?

    - by Noctis Skytower
    Whitespace Assembler #! /usr/bin/env python """Assembler.py Compiles a program from "Assembly" folder into "Program" folder. Can be executed directly by double-click or on the command line. Give name of *.WSA file without extension (example: stack_calc).""" ################################################################################ __author__ = 'Stephen "Zero" Chappell <[email protected]>' __date__ = '14 March 2010' __version__ = '$Revision: 3 $' ################################################################################ import string from Interpreter import INS, MNEMONIC ################################################################################ def parse(code): program = [] process_virtual(program, code) process_control(program) return tuple(program) def process_virtual(program, code): for line, text in enumerate(code.split('\n')): if not text or text[0] == '#': continue if text.startswith('part '): parse_part(program, line, text[5:]) elif text.startswith(' '): parse_code(program, line, text[5:]) else: syntax_error(line) def syntax_error(line): raise SyntaxError('Line ' + str(line + 1)) ################################################################################ def process_control(program): parts = get_parts(program) names = dict(pair for pair in zip(parts, generate_index())) correct_control(program, names) def get_parts(program): parts = [] for ins in program: if isinstance(ins, tuple): ins, arg = ins if ins == INS.PART: if arg in parts: raise NameError('Part definition was found twice: ' + arg) parts.append(arg) return parts def generate_index(): index = 1 while True: yield index index *= -1 if index > 0: index += 1 def correct_control(program, names): for index, ins in enumerate(program): if isinstance(ins, tuple): ins, arg = ins if ins in HAS_LABEL: if arg not in names: raise NameError('Part definition was never found: ' + arg) program[index] = (ins, names[arg]) ################################################################################ def parse_part(program, line, text): if not valid_label(text): syntax_error(line) program.append((INS.PART, text)) def valid_label(text): if not between_quotes(text): return False label = text[1:-1] if not valid_name(label): return False return True def between_quotes(text): if len(text) < 3: return False if text.count('"') != 2: return False if text[0] != '"' or text[-1] != '"': return False return True def valid_name(label): valid_characters = string.ascii_letters + string.digits + '_' valid_set = frozenset(valid_characters) label_set = frozenset(label) if len(label_set - valid_set) != 0: return False return True ################################################################################ from Interpreter import HAS_LABEL, Program NO_ARGS = Program.NO_ARGS HAS_ARG = Program.HAS_ARG TWO_WAY = tuple(set(NO_ARGS) & set(HAS_ARG)) ################################################################################ def parse_code(program, line, text): for ins, word in enumerate(MNEMONIC): if text.startswith(word): check_code(program, line, text[len(word):], ins) break else: syntax_error(line) def check_code(program, line, text, ins): if ins in TWO_WAY: if text: number = parse_number(line, text) program.append((ins, number)) else: program.append(ins) elif ins in HAS_LABEL: text = parse_label(line, text) program.append((ins, text)) elif ins in HAS_ARG: number = parse_number(line, text) program.append((ins, number)) elif ins in NO_ARGS: if text: syntax_error(line) program.append(ins) else: syntax_error(line) def parse_label(line, text): if not text or text[0] != ' ': syntax_error(line) text = text[1:] if not valid_label(text): syntax_error(line) return text ################################################################################ def parse_number(line, text): if not valid_number(text): syntax_error(line) return int(text) def valid_number(text): if len(text) < 2: return False if text[0] != ' ': return False text = text[1:] if '+' in text and '-' in text: return False if '+' in text: if text.count('+') != 1: return False if text[0] != '+': return False text = text[1:] if not text: return False if '-' in text: if text.count('-') != 1: return False if text[0] != '-': return False text = text[1:] if not text: return False valid_set = frozenset(string.digits) value_set = frozenset(text) if len(value_set - valid_set) != 0: return False return True ################################################################################ ################################################################################ from Interpreter import partition_number VMC_2_TRI = { (INS.PUSH, True): (0, 0), (INS.COPY, False): (0, 2, 0), (INS.COPY, True): (0, 1, 0), (INS.SWAP, False): (0, 2, 1), (INS.AWAY, False): (0, 2, 2), (INS.AWAY, True): (0, 1, 2), (INS.ADD, False): (1, 0, 0, 0), (INS.SUB, False): (1, 0, 0, 1), (INS.MUL, False): (1, 0, 0, 2), (INS.DIV, False): (1, 0, 1, 0), (INS.MOD, False): (1, 0, 1, 1), (INS.SET, False): (1, 1, 0), (INS.GET, False): (1, 1, 1), (INS.PART, True): (2, 0, 0), (INS.CALL, True): (2, 0, 1), (INS.GOTO, True): (2, 0, 2), (INS.ZERO, True): (2, 1, 0), (INS.LESS, True): (2, 1, 1), (INS.BACK, False): (2, 1, 2), (INS.EXIT, False): (2, 2, 2), (INS.OCHR, False): (1, 2, 0, 0), (INS.OINT, False): (1, 2, 0, 1), (INS.ICHR, False): (1, 2, 1, 0), (INS.IINT, False): (1, 2, 1, 1) } ################################################################################ def to_trinary(program): trinary_code = [] for ins in program: if isinstance(ins, tuple): ins, arg = ins trinary_code.extend(VMC_2_TRI[(ins, True)]) trinary_code.extend(from_number(arg)) else: trinary_code.extend(VMC_2_TRI[(ins, False)]) return tuple(trinary_code) def from_number(arg): code = [int(arg < 0)] if arg: for bit in reversed(list(partition_number(abs(arg), 2))): code.append(bit) return code + [2] return code + [0, 2] to_ws = lambda trinary: ''.join(' \t\n'[index] for index in trinary) def compile_wsa(source): program = parse(source) trinary = to_trinary(program) ws_code = to_ws(trinary) return ws_code ################################################################################ ################################################################################ import os import sys import time import traceback def main(): name, source, command_line, error = get_source() if not error: start = time.clock() try: ws_code = compile_wsa(source) except: print('ERROR: File could not be compiled.\n') traceback.print_exc() error = True else: path = os.path.join('Programs', name + '.ws') try: open(path, 'w').write(ws_code) except IOError as err: print(err) error = True else: div, mod = divmod((time.clock() - start) * 1000, 1) args = int(div), '{:.3}'.format(mod)[1:] print('DONE: Comipled in {}{} ms'.format(*args)) handle_close(error, command_line) def get_source(): if len(sys.argv) > 1: command_line = True name = sys.argv[1] else: command_line = False try: name = input('Source File: ') except: return None, None, False, True print() path = os.path.join('Assembly', name + '.wsa') try: return name, open(path).read(), command_line, False except IOError as err: print(err) return None, None, command_line, True def handle_close(error, command_line): if error: usage = 'Usage: {} <assembly>'.format(os.path.basename(sys.argv[0])) print('\n{}\n{}'.format('-' * len(usage), usage)) if not command_line: time.sleep(10) ################################################################################ if __name__ == '__main__': main() Whitespace Helpers #! /usr/bin/env python """Helpers.py Includes a function to encode Python strings into my WSA format. Has a "PRINT_LINE" function that can be copied to a WSA program. Contains a "PRINT" function and documentation as an explanation.""" ################################################################################ __author__ = 'Stephen "Zero" Chappell <[email protected]>' __date__ = '14 March 2010' __version__ = '$Revision: 1 $' ################################################################################ def encode_string(string, addr): print(' push', addr) print(' push', len(string)) print(' set') addr += 1 for offset, character in enumerate(string): print(' push', addr + offset) print(' push', ord(character)) print(' set') ################################################################################ # Prints a string with newline. # push addr # call "PRINT_LINE" """ part "PRINT_LINE" call "PRINT" push 10 ochr back """ ################################################################################ # def print(array): # if len(array) <= 0: # return # offset = 1 # while len(array) - offset >= 0: # ptr = array.ptr + offset # putch(array[ptr]) # offset += 1 """ part "PRINT" # Line 1-2 copy get less "__PRINT_RET_1" copy get zero "__PRINT_RET_1" # Line 3 push 1 # Line 4 part "__PRINT_LOOP" copy copy 2 get swap sub less "__PRINT_RET_2" # Line 5 copy 1 copy 1 add # Line 6 get ochr # Line 7 push 1 add goto "__PRINT_LOOP" part "__PRINT_RET_2" away part "__PRINT_RET_1" away back """ Whitespace Interpreter #! /usr/bin/env python """Interpreter.py Runs programs in "Programs" and creates *.WSO files when needed. Can be executed directly by double-click or on the command line. If run on command line, add "ASM" flag to dump program assembly.""" ################################################################################ __author__ = 'Stephen "Zero" Chappell <[email protected]>' __date__ = '14 March 2010' __version__ = '$Revision: 4 $' ################################################################################ def test_file(path): disassemble(parse(trinary(load(path))), True) ################################################################################ load = lambda ws: ''.join(c for r in open(ws) for c in r if c in ' \t\n') trinary = lambda ws: tuple(' \t\n'.index(c) for c in ws) ################################################################################ def enum(names): names = names.replace(',', ' ').split() space = dict((reversed(pair) for pair in enumerate(names)), __slots__=()) return type('enum', (object,), space)() INS = enum('''\ PUSH, COPY, SWAP, AWAY, \ ADD, SUB, MUL, DIV, MOD, \ SET, GET, \ PART, CALL, GOTO, ZERO, LESS, BACK, EXIT, \ OCHR, OINT, ICHR, IINT''') ################################################################################ def parse(code): ins = iter(code).__next__ program = [] while True: try: imp = ins() except StopIteration: return tuple(program) if imp == 0: # [Space] parse_stack(ins, program) elif imp == 1: # [Tab] imp = ins() if imp == 0: # [Tab][Space] parse_math(ins, program) elif imp == 1: # [Tab][Tab] parse_heap(ins, program) else: # [Tab][Line] parse_io(ins, program) else: # [Line] parse_flow(ins, program) def parse_number(ins): sign = ins() if sign == 2: raise StopIteration() buffer = '' code = ins() if code == 2: raise StopIteration() while code != 2: buffer += str(code) code = ins() if sign == 1: return int(buffer, 2) * -1 return int(buffer, 2) ################################################################################ def parse_stack(ins, program): code = ins() if code == 0: # [Space] number = parse_number(ins) program.append((INS.PUSH, number)) elif code == 1: # [Tab] code = ins() number = parse_number(ins) if code == 0: # [Tab][Space] program.append((INS.COPY, number)) elif code == 1: # [Tab][Tab] raise StopIteration() else: # [Tab][Line] program.append((INS.AWAY, number)) else: # [Line] code = ins() if code == 0: # [Line][Space] program.append(INS.COPY) elif code == 1: # [Line][Tab] program.append(INS.SWAP) else: # [Line][Line] program.append(INS.AWAY) def parse_math(ins, program): code = ins() if code == 0: # [Space] code = ins() if code == 0: # [Space][Space] program.append(INS.ADD) elif code == 1: # [Space][Tab] program.append(INS.SUB) else: # [Space][Line] program.append(INS.MUL) elif code == 1: # [Tab] code = ins() if code == 0: # [Tab][Space] program.append(INS.DIV) elif code == 1: # [Tab][Tab] program.append(INS.MOD) else: # [Tab][Line] raise StopIteration() else: # [Line] raise StopIteration() def parse_heap(ins, program): code = ins() if code == 0: # [Space] program.append(INS.SET) elif code == 1: # [Tab] program.append(INS.GET) else: # [Line] raise StopIteration() def parse_io(ins, program): code = ins() if code == 0: # [Space] code = ins() if code == 0: # [Space][Space] program.append(INS.OCHR) elif code == 1: # [Space][Tab] program.append(INS.OINT) else: # [Space][Line] raise StopIteration() elif code == 1: # [Tab] code = ins() if code == 0: # [Tab][Space] program.append(INS.ICHR) elif code == 1: # [Tab][Tab] program.append(INS.IINT) else: # [Tab][Line] raise StopIteration() else: # [Line] raise StopIteration() def parse_flow(ins, program): code = ins() if code == 0: # [Space] code = ins() label = parse_number(ins) if code == 0: # [Space][Space] program.append((INS.PART, label)) elif code == 1: # [Space][Tab] program.append((INS.CALL, label)) else: # [Space][Line] program.append((INS.GOTO, label)) elif code == 1: # [Tab] code = ins() if code == 0: # [Tab][Space] label = parse_number(ins) program.append((INS.ZERO, label)) elif code == 1: # [Tab][Tab] label = parse_number(ins) program.append((INS.LESS, label)) else: # [Tab][Line] program.append(INS.BACK) else: # [Line] code = ins() if code == 2: # [Line][Line] program.append(INS.EXIT) else: # [Line][Space] or [Line][Tab] raise StopIteration() ################################################################################ MNEMONIC = '\ push copy swap away add sub mul div mod set get part \ call goto zero less back exit ochr oint ichr iint'.split() HAS_ARG = [getattr(INS, name) for name in 'PUSH COPY AWAY PART CALL GOTO ZERO LESS'.split()] HAS_LABEL = [getattr(INS, name) for name in 'PART CALL GOTO ZERO LESS'.split()] def disassemble(program, names=False): if names: names = create_names(program) for ins in program: if isinstance(ins, tuple): ins, arg = ins assert ins in HAS_ARG has_arg = True else: assert INS.PUSH <= ins <= INS.IINT has_arg = False if ins == INS.PART: if names: print(MNEMONIC[ins], '"' + names[arg] + '"') else: print(MNEMONIC[ins], arg) elif has_arg and ins in HAS_ARG: if ins in HAS_LABEL and names: assert arg in names print(' ' + MNEMONIC[ins], '"' + names[arg] + '"') else: print(' ' + MNEMONIC[ins], arg) else: print(' ' + MNEMONIC[ins]) ################################################################################ def create_names(program): names = {} number = 1 for ins in program: if isinstance(ins, tuple) and ins[0] == INS.PART: label = ins[1] assert label not in names names[label] = number_to_name(number) number += 1 return names def number_to_name(number): name = '' for offset in reversed(list(partition_number(number, 27))): if offset: name += chr(ord('A') + offset - 1) else: name += '_' return name def partition_number(number, base): div, mod = divmod(number, base) yield mod while div: div, mod = divmod(div, base) yield mod ################################################################################ CODE = (' \t\n', ' \n ', ' \t \t\n', ' \n\t', ' \n\n', ' \t\n \t\n', '\t ', '\t \t', '\t \n', '\t \t ', '\t \t\t', '\t\t ', '\t\t\t', '\n \t\n', '\n \t \t\n', '\n \n \t\n', '\n\t \t\n', '\n\t\t \t\n', '\n\t\n', '\n\n\n', '\t\n ', '\t\n \t', '\t\n\t ', '\t\n\t\t') EXAMPLE = ''.join(CODE) ################################################################################ NOTES = '''\ STACK ===== push number copy copy number swap away away number MATH ==== add sub mul div mod HEAP ==== set get FLOW ==== part label call label goto label zero label less label back exit I/O === ochr oint ichr iint''' ################################################################################ ################################################################################ class Stack: def __init__(self): self.__data = [] # Stack Operators def push(self, number): self.__data.append(number) def copy(self, number=None): if number is None: self.__data.append(self.__data[-1]) else: size = len(self.__data) index = size - number - 1 assert 0 <= index < size self.__data.append(self.__data[index]) def swap(self): self.__data[-2], self.__data[-1] = self.__data[-1], self.__data[-2] def away(self, number=None): if number is None: self.__data.pop() else: size = len(self.__data) index = size - number - 1 assert 0 <= index < size del self.__data[index:-1] # Math Operators def add(self): suffix = self.__data.pop() prefix = self.__data.pop() self.__data.append(prefix + suffix) def sub(self): suffix = self.__data.pop() prefix = self.__data.pop() self.__data.append(prefix - suffix) def mul(self): suffix = self.__data.pop() prefix = self.__data.pop() self.__data.append(prefix * suffix) def div(self): suffix = self.__data.pop() prefix = self.__data.pop() self.__data.append(prefix // suffix) def mod(self): suffix = self.__data.pop() prefix = self.__data.pop() self.__data.append(prefix % suffix) # Program Operator def pop(self): return self.__data.pop() ################################################################################ class Heap: def __init__(self): self.__data = {} def set_(self, addr, item): if item: self.__data[addr] = item elif addr in self.__data: del self.__data[addr] def get_(self, addr): return self.__data.get(addr, 0) ################################################################################ import os import zlib import msvcrt import pickle import string class CleanExit(Exception): pass NOP = lambda arg: None DEBUG_WHITESPACE = False ################################################################################ class Program: NO_ARGS = INS.COPY, INS.SWAP, INS.AWAY, INS.ADD, \ INS.SUB, INS.MUL, INS.DIV, INS.MOD, \ INS.SET, INS.GET, INS.BACK, INS.EXIT, \ INS.OCHR, INS.OINT, INS.ICHR, INS.IINT HAS_ARG = INS.PUSH, INS.COPY, INS.AWAY, INS.PART, \ INS.CALL, INS.GOTO, INS.ZERO, INS.LESS def __init__(self, code): self.__data = code self.__validate() self.__build_jump() self.__check_jump() self.__setup_exec() def __setup_exec(self): self.__iptr = 0 self.__stck = stack = Stack() self.__heap = Heap() self.__cast = [] self.__meth = (stack.push, stack.copy, stack.swap, stack.away, stack.add, stack.sub, stack.mul, stack.div, stack.mod, self.__set, self.__get, NOP, self.__call, self.__goto, self.__zero, self.__less, self.__back, self.__exit, self.__ochr, self.__oint, self.__ichr, self.__iint) def step(self): ins = self.__data[self.__iptr] self.__iptr += 1 if isinstance(ins, tuple): self.__meth[ins[0]](ins[1]) else: self.__meth[ins]() def run(self): while True: ins = self.__data[self.__iptr] self.__iptr += 1 if isinstance(ins, tuple): self.__meth[ins[0]](ins[1]) else: self.__meth[ins]() def __oint(self): for digit in str(self.__stck.pop()): msvcrt.putwch(digit) def __ichr(self): addr = self.__stck.pop() # Input Routine while msvcrt.kbhit(): msvcrt.getwch() while True: char = msvcrt.getwch() if char in '\x00\xE0': msvcrt.getwch() elif char in string.printable: char = char.replace('\r', '\n') msvcrt.putwch(char) break item = ord(char) # Storing Number self.__heap.set_(addr, item) def __iint(self): addr = self.__stck.pop() # Input Routine while msvcrt.kbhit(): msvcrt.getwch() buff = '' char = msvcrt.getwch() while char != '\r' or not buff: if char in '\x00\xE0': msvcrt.getwch() elif char in '+-' and not buff: msvcrt.putwch(char) buff += char elif '0' <= char <= '9': msvcrt.putwch(char) buff += char elif char == '\b': if buff: buff = buff[:-1] msvcrt.putwch(char) msvcrt.putwch(' ') msvcrt.putwch(char) char = msvcrt.getwch() msvcrt.putwch(char) msvcrt.putwch('\n') item = int(buff) # Storing Number self.__heap.set_(addr, item) def __goto(self, label): self.__iptr = self.__jump[label] def __zero(self, label): if self.__stck.pop() == 0: self.__iptr = self.__jump[label] def __less(self, label): if self.__stck.pop() < 0: self.__iptr = self.__jump[label] def __exit(self): self.__setup_exec() raise CleanExit() def __set(self): item = self.__stck.pop() addr = self.__stck.po

    Read the article

  • java: List wrapper where get()/set() is allowed but add/remove is not

    - by Jason S
    I need to wrap a List<T> with some class that allows calls to set/get but does not allow add/remove calls, so that the list remains "stuck" at a fixed length. I think I have a thin wrapper class (below) that will work, but I'm not 100% positive. Did I miss anything obvious? import java.util.Collection; import java.util.Iterator; import java.util.List; import java.util.ListIterator; class RestrictedListWrapper<T> implements List<T> { static <T> T fail() throws UnsupportedOperationException { throw new UnsupportedOperationException(); } static private class IteratorWrapper<T> implements ListIterator<T> { final private ListIterator<T> iter; private IteratorWrapper(ListIterator<T> iter) { this.iter = iter; } static public <T> RestrictedListWrapper.IteratorWrapper<T> wrap(ListIterator<T> target) { return new RestrictedListWrapper.IteratorWrapper<T>(target); } @Override public void add(T e) { fail(); } @Override public boolean hasNext() { return this.iter.hasNext(); } @Override public boolean hasPrevious() { return this.iter.hasPrevious(); } @Override public T next() { return this.iter.next(); } @Override public int nextIndex() { return this.iter.nextIndex(); } @Override public T previous() { return this.iter.previous(); } @Override public int previousIndex() { return this.iter.previousIndex(); } @Override public void remove() { fail(); } @Override public void set(T e) { this.iter.set(e); } } final private List<T> list; private RestrictedListWrapper(List<T> list) { this.list = list; } static public <T> RestrictedListWrapper<T> wrap(List<T> target) { return new RestrictedListWrapper<T>(target); } @Override public boolean add(T arg0) { return fail(); } @Override public void add(int index, T element) { fail(); } @Override public boolean addAll(Collection<? extends T> arg0) { return fail(); } @Override public boolean addAll(int arg0, Collection<? extends T> arg1) { return fail(); } /** * clear() allows setting all members of the list to null */ @Override public void clear() { ListIterator<T> it = this.list.listIterator(); while (it.hasNext()) { it.set(null); it.next(); } } @Override public boolean contains(Object o) { return this.list.contains(o); } @Override public boolean containsAll(Collection<?> c) { return this.list.containsAll(c); } @Override public T get(int index) { return this.list.get(index); } @Override public int indexOf(Object o) { return this.list.indexOf(o); } @Override public boolean isEmpty() { return false; } @Override public Iterator<T> iterator() { return listIterator(); } @Override public int lastIndexOf(Object o) { return this.list.lastIndexOf(o); } @Override public ListIterator<T> listIterator() { return IteratorWrapper.wrap(this.list.listIterator()); } @Override public ListIterator<T> listIterator(int index) { return IteratorWrapper.wrap(this.list.listIterator(index)); } @Override public boolean remove(Object o) { return fail(); } @Override public T remove(int index) { fail(); return fail(); } @Override public boolean removeAll(Collection<?> c) { return fail(); } @Override public boolean retainAll(Collection<?> c) { return fail(); } @Override public T set(int index, T element) { return this.list.set(index, element); } @Override public int size() { return this.list.size(); } @Override public List<T> subList(int fromIndex, int toIndex) { return new RestrictedListWrapper<T>(this.list.subList(fromIndex, toIndex)); } @Override public Object[] toArray() { return this.list.toArray(); } @Override public <T> T[] toArray(T[] a) { return this.list.toArray(a); } }

    Read the article

  • How can this PHP code be improved? What should be changed?

    - by Noctis Skytower
    This is a custom encryption library. I do not know much about PHP's standard library of functions and was wondering if the following code can be improved in any way. The implementation should yield the same results, the API should remain as it is, but ways to make is more PHP-ish would be greatly appreciated. Code <?php /*************************************** Create random major and minor SPICE key. ***************************************/ function crypt_major() { $all = range("\x00", "\xFF"); shuffle($all); $major_key = implode("", $all); return $major_key; } function crypt_minor() { $sample = array(); do { array_push($sample, 0, 1, 2, 3); } while (count($sample) != 256); shuffle($sample); $list = array(); for ($index = 0; $index < 64; $index++) { $b12 = $sample[$index * 4] << 6; $b34 = $sample[$index * 4 + 1] << 4; $b56 = $sample[$index * 4 + 2] << 2; $b78 = $sample[$index * 4 + 3]; array_push($list, $b12 + $b34 + $b56 + $b78); } $minor_key = implode("", array_map("chr", $list)); return $minor_key; } /*************************************** Create the SPICE key via the given name. ***************************************/ function named_major($name) { srand(crc32($name)); return crypt_major(); } function named_minor($name) { srand(crc32($name)); return crypt_minor(); } /*************************************** Check validity for major and minor keys. ***************************************/ function _check_major($key) { if (is_string($key) && strlen($key) == 256) { foreach (range("\x00", "\xFF") as $char) { if (substr_count($key, $char) == 0) { return FALSE; } } return TRUE; } return FALSE; } function _check_minor($key) { if (is_string($key) && strlen($key) == 64) { $indexs = array(); foreach (array_map("ord", str_split($key)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($indexs, ($byte >> $shift) & 3); } } $dict = array_count_values($indexs); foreach (range(0, 3) as $index) { if ($dict[$index] != 64) { return FALSE; } } return TRUE; } return FALSE; } /*************************************** Create encode maps for encode functions. ***************************************/ function _encode_map_1($major) { return array_map("ord", str_split($major)); } function _encode_map_2($minor) { $map_2 = array(array(), array(), array(), array()); $list = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($list, ($byte >> $shift) & 3); } } for ($byte = 0; $byte < 256; $byte++) { array_push($map_2[$list[$byte]], chr($byte)); } return $map_2; } /*************************************** Create decode maps for decode functions. ***************************************/ function _decode_map_1($minor) { $map_1 = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($map_1, ($byte >> $shift) & 3); } } return $map_1; }function _decode_map_2($major) { $map_2 = array(); $temp = array_map("ord", str_split($major)); for ($byte = 0; $byte < 256; $byte++) { $map_2[$temp[$byte]] = chr($byte); } return $map_2; } /*************************************** Encrypt or decrypt the string with maps. ***************************************/ function _encode($string, $map_1, $map_2) { $cache = ""; foreach (str_split($string) as $char) { $byte = $map_1[ord($char)]; foreach (range(6, 0, 2) as $shift) { $cache .= $map_2[($byte >> $shift) & 3][mt_rand(0, 63)]; } } return $cache; } function _decode($string, $map_1, $map_2) { $cache = ""; $temp = str_split($string); for ($iter = 0; $iter < strlen($string) / 4; $iter++) { $b12 = $map_1[ord($temp[$iter * 4])] << 6; $b34 = $map_1[ord($temp[$iter * 4 + 1])] << 4; $b56 = $map_1[ord($temp[$iter * 4 + 2])] << 2; $b78 = $map_1[ord($temp[$iter * 4 + 3])]; $cache .= $map_2[$b12 + $b34 + $b56 + $b78]; } return $cache; } /*************************************** This is the public interface for coding. ***************************************/ function encode_string($string, $major, $minor) { if (is_string($string)) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _encode_map_1($major); $map_2 = _encode_map_2($minor); return _encode($string, $map_1, $map_2); } } return FALSE; } function decode_string($string, $major, $minor) { if (is_string($string) && strlen($string) % 4 == 0) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _decode_map_1($minor); $map_2 = _decode_map_2($major); return _decode($string, $map_1, $map_2); } } return FALSE; } ?> This is a sample showing how the code is being used. Hex editors may be of help with the input / output. Example <?php # get and process all of the form data @ $input = htmlspecialchars($_POST["input"]); @ $majorname = htmlspecialchars($_POST["majorname"]); @ $minorname = htmlspecialchars($_POST["minorname"]); @ $majorkey = htmlspecialchars($_POST["majorkey"]); @ $minorkey = htmlspecialchars($_POST["minorkey"]); @ $output = htmlspecialchars($_POST["output"]); # process the submissions by operation # CREATE @ $operation = $_POST["operation"]; if ($operation == "Create") { if (strlen($_POST["majorname"]) == 0) { $majorkey = bin2hex(crypt_major()); } if (strlen($_POST["minorname"]) == 0) { $minorkey = bin2hex(crypt_minor()); } if (strlen($_POST["majorname"]) != 0) { $majorkey = bin2hex(named_major($_POST["majorname"])); } if (strlen($_POST["minorname"]) != 0) { $minorkey = bin2hex(named_minor($_POST["minorname"])); } } # ENCRYPT or DECRYPT function is_hex($char) { if ($char == "0"): return TRUE; elseif ($char == "1"): return TRUE; elseif ($char == "2"): return TRUE; elseif ($char == "3"): return TRUE; elseif ($char == "4"): return TRUE; elseif ($char == "5"): return TRUE; elseif ($char == "6"): return TRUE; elseif ($char == "7"): return TRUE; elseif ($char == "8"): return TRUE; elseif ($char == "9"): return TRUE; elseif ($char == "a"): return TRUE; elseif ($char == "b"): return TRUE; elseif ($char == "c"): return TRUE; elseif ($char == "d"): return TRUE; elseif ($char == "e"): return TRUE; elseif ($char == "f"): return TRUE; else: return FALSE; endif; } function hex2bin($str) { if (strlen($str) % 2 == 0): $string = strtolower($str); else: $string = strtolower("0" . $str); endif; $cache = ""; $temp = str_split($str); for ($index = 0; $index < count($temp) / 2; $index++) { $h1 = $temp[$index * 2]; if (is_hex($h1)) { $h2 = $temp[$index * 2 + 1]; if (is_hex($h2)) { $cache .= chr(hexdec($h1 . $h2)); } else { return FALSE; } } else { return FALSE; } } return $cache; } if ($operation == "Encrypt" || $operation == "Decrypt") { # CHECK FOR ANY ERROR $errors = array(); if (strlen($_POST["input"]) == 0) { $output = ""; } $binmajor = hex2bin($_POST["majorkey"]); if (strlen($_POST["majorkey"]) == 0) { array_push($errors, "There must be a major key."); } elseif ($binmajor == FALSE) { array_push($errors, "The major key must be in hex."); } elseif (_check_major($binmajor) == FALSE) { array_push($errors, "The major key is corrupt."); } $binminor = hex2bin($_POST["minorkey"]); if (strlen($_POST["minorkey"]) == 0) { array_push($errors, "There must be a minor key."); } elseif ($binminor == FALSE) { array_push($errors, "The minor key must be in hex."); } elseif (_check_minor($binminor) == FALSE) { array_push($errors, "The minor key is corrupt."); } if ($_POST["operation"] == "Decrypt") { $bininput = hex2bin(str_replace("\r", "", str_replace("\n", "", $_POST["input"]))); if ($bininput == FALSE) { if (strlen($_POST["input"]) != 0) { array_push($errors, "The input data must be in hex."); } } elseif (strlen($bininput) % 4 != 0) { array_push($errors, "The input data is corrupt."); } } if (count($errors) != 0) { # ERRORS ARE FOUND $output = "ERROR:"; foreach ($errors as $error) { $output .= "\n" . $error; } } elseif (strlen($_POST["input"]) != 0) { # CONTINUE WORKING if ($_POST["operation"] == "Encrypt") { # ENCRYPT $output = substr(chunk_split(bin2hex(encode_string($_POST["input"], $binmajor, $binminor)), 58), 0, -2); } else { # DECRYPT $output = htmlspecialchars(decode_string($bininput, $binmajor, $binminor)); } } } # echo the form with the values filled echo "<P><TEXTAREA class=maintextarea name=input rows=25 cols=25>" . $input . "</TEXTAREA></P>\n"; echo "<P>Major Name:</P>\n"; echo "<P><INPUT id=textbox1 name=majorname value=\"" . $majorname . "\"></P>\n"; echo "<P>Minor Name:</P>\n"; echo "<P><INPUT id=textbox1 name=minorname value=\"" . $minorname . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Create name=operation>\n"; echo "</DIV>\n"; echo "<P>Major Key:</P>\n"; echo "<P><INPUT id=textbox1 name=majorkey value=\"" . $majorkey . "\"></P>\n"; echo "<P>Minor Key:</P>\n"; echo "<P><INPUT id=textbox1 name=minorkey value=\"" . $minorkey . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Encrypt name=operation> \n"; echo "<INPUT class=submit type=submit value=Decrypt name=operation> </DIV>\n"; echo "<P>Result:</P>\n"; echo "<P><TEXTAREA class=maintextarea name=output rows=25 readOnly cols=25>" . $output . "</TEXTAREA></P></DIV></FORM>\n"; ?> What should be editted for better memory efficiency or faster execution?

    Read the article

  • How can this PHP code be improved? What should change?

    - by Noctis Skytower
    This is a custom encryption library. I do not know much about PHP's standard library of functions and was wondering if the following code can be improved in any way. The implementation should yield the same results, the API should remain as it is, but ways to make is more PHP-ish would be greatly appreciated. Code <?php /*************************************** Create random major and minor SPICE key. ***************************************/ function crypt_major() { $all = range("\x00", "\xFF"); shuffle($all); $major_key = implode("", $all); return $major_key; } function crypt_minor() { $sample = array(); do { array_push($sample, 0, 1, 2, 3); } while (count($sample) != 256); shuffle($sample); $list = array(); for ($index = 0; $index < 64; $index++) { $b12 = $sample[$index * 4] << 6; $b34 = $sample[$index * 4 + 1] << 4; $b56 = $sample[$index * 4 + 2] << 2; $b78 = $sample[$index * 4 + 3]; array_push($list, $b12 + $b34 + $b56 + $b78); } $minor_key = implode("", array_map("chr", $list)); return $minor_key; } /*************************************** Create the SPICE key via the given name. ***************************************/ function named_major($name) { srand(crc32($name)); return crypt_major(); } function named_minor($name) { srand(crc32($name)); return crypt_minor(); } /*************************************** Check validity for major and minor keys. ***************************************/ function _check_major($key) { if (is_string($key) && strlen($key) == 256) { foreach (range("\x00", "\xFF") as $char) { if (substr_count($key, $char) == 0) { return FALSE; } } return TRUE; } return FALSE; } function _check_minor($key) { if (is_string($key) && strlen($key) == 64) { $indexs = array(); foreach (array_map("ord", str_split($key)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($indexs, ($byte >> $shift) & 3); } } $dict = array_count_values($indexs); foreach (range(0, 3) as $index) { if ($dict[$index] != 64) { return FALSE; } } return TRUE; } return FALSE; } /*************************************** Create encode maps for encode functions. ***************************************/ function _encode_map_1($major) { return array_map("ord", str_split($major)); } function _encode_map_2($minor) { $map_2 = array(array(), array(), array(), array()); $list = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($list, ($byte >> $shift) & 3); } } for ($byte = 0; $byte < 256; $byte++) { array_push($map_2[$list[$byte]], chr($byte)); } return $map_2; } /*************************************** Create decode maps for decode functions. ***************************************/ function _decode_map_1($minor) { $map_1 = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($map_1, ($byte >> $shift) & 3); } } return $map_1; }function _decode_map_2($major) { $map_2 = array(); $temp = array_map("ord", str_split($major)); for ($byte = 0; $byte < 256; $byte++) { $map_2[$temp[$byte]] = chr($byte); } return $map_2; } /*************************************** Encrypt or decrypt the string with maps. ***************************************/ function _encode($string, $map_1, $map_2) { $cache = ""; foreach (str_split($string) as $char) { $byte = $map_1[ord($char)]; foreach (range(6, 0, 2) as $shift) { $cache .= $map_2[($byte >> $shift) & 3][mt_rand(0, 63)]; } } return $cache; } function _decode($string, $map_1, $map_2) { $cache = ""; $temp = str_split($string); for ($iter = 0; $iter < strlen($string) / 4; $iter++) { $b12 = $map_1[ord($temp[$iter * 4])] << 6; $b34 = $map_1[ord($temp[$iter * 4 + 1])] << 4; $b56 = $map_1[ord($temp[$iter * 4 + 2])] << 2; $b78 = $map_1[ord($temp[$iter * 4 + 3])]; $cache .= $map_2[$b12 + $b34 + $b56 + $b78]; } return $cache; } /*************************************** This is the public interface for coding. ***************************************/ function encode_string($string, $major, $minor) { if (is_string($string)) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _encode_map_1($major); $map_2 = _encode_map_2($minor); return _encode($string, $map_1, $map_2); } } return FALSE; } function decode_string($string, $major, $minor) { if (is_string($string) && strlen($string) % 4 == 0) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _decode_map_1($minor); $map_2 = _decode_map_2($major); return _decode($string, $map_1, $map_2); } } return FALSE; } ?> This is a sample showing how the code is being used. Hex editors may be of help with the input / output. Example <?php # get and process all of the form data @ $input = htmlspecialchars($_POST["input"]); @ $majorname = htmlspecialchars($_POST["majorname"]); @ $minorname = htmlspecialchars($_POST["minorname"]); @ $majorkey = htmlspecialchars($_POST["majorkey"]); @ $minorkey = htmlspecialchars($_POST["minorkey"]); @ $output = htmlspecialchars($_POST["output"]); # process the submissions by operation # CREATE @ $operation = $_POST["operation"]; if ($operation == "Create") { if (strlen($_POST["majorname"]) == 0) { $majorkey = bin2hex(crypt_major()); } if (strlen($_POST["minorname"]) == 0) { $minorkey = bin2hex(crypt_minor()); } if (strlen($_POST["majorname"]) != 0) { $majorkey = bin2hex(named_major($_POST["majorname"])); } if (strlen($_POST["minorname"]) != 0) { $minorkey = bin2hex(named_minor($_POST["minorname"])); } } # ENCRYPT or DECRYPT function is_hex($char) { if ($char == "0"): return TRUE; elseif ($char == "1"): return TRUE; elseif ($char == "2"): return TRUE; elseif ($char == "3"): return TRUE; elseif ($char == "4"): return TRUE; elseif ($char == "5"): return TRUE; elseif ($char == "6"): return TRUE; elseif ($char == "7"): return TRUE; elseif ($char == "8"): return TRUE; elseif ($char == "9"): return TRUE; elseif ($char == "a"): return TRUE; elseif ($char == "b"): return TRUE; elseif ($char == "c"): return TRUE; elseif ($char == "d"): return TRUE; elseif ($char == "e"): return TRUE; elseif ($char == "f"): return TRUE; else: return FALSE; endif; } function hex2bin($str) { if (strlen($str) % 2 == 0): $string = strtolower($str); else: $string = strtolower("0" . $str); endif; $cache = ""; $temp = str_split($str); for ($index = 0; $index < count($temp) / 2; $index++) { $h1 = $temp[$index * 2]; if (is_hex($h1)) { $h2 = $temp[$index * 2 + 1]; if (is_hex($h2)) { $cache .= chr(hexdec($h1 . $h2)); } else { return FALSE; } } else { return FALSE; } } return $cache; } if ($operation == "Encrypt" || $operation == "Decrypt") { # CHECK FOR ANY ERROR $errors = array(); if (strlen($_POST["input"]) == 0) { $output = ""; } $binmajor = hex2bin($_POST["majorkey"]); if (strlen($_POST["majorkey"]) == 0) { array_push($errors, "There must be a major key."); } elseif ($binmajor == FALSE) { array_push($errors, "The major key must be in hex."); } elseif (_check_major($binmajor) == FALSE) { array_push($errors, "The major key is corrupt."); } $binminor = hex2bin($_POST["minorkey"]); if (strlen($_POST["minorkey"]) == 0) { array_push($errors, "There must be a minor key."); } elseif ($binminor == FALSE) { array_push($errors, "The minor key must be in hex."); } elseif (_check_minor($binminor) == FALSE) { array_push($errors, "The minor key is corrupt."); } if ($_POST["operation"] == "Decrypt") { $bininput = hex2bin(str_replace("\r", "", str_replace("\n", "", $_POST["input"]))); if ($bininput == FALSE) { if (strlen($_POST["input"]) != 0) { array_push($errors, "The input data must be in hex."); } } elseif (strlen($bininput) % 4 != 0) { array_push($errors, "The input data is corrupt."); } } if (count($errors) != 0) { # ERRORS ARE FOUND $output = "ERROR:"; foreach ($errors as $error) { $output .= "\n" . $error; } } elseif (strlen($_POST["input"]) != 0) { # CONTINUE WORKING if ($_POST["operation"] == "Encrypt") { # ENCRYPT $output = substr(chunk_split(bin2hex(encode_string($_POST["input"], $binmajor, $binminor)), 58), 0, -2); } else { # DECRYPT $output = htmlspecialchars(decode_string($bininput, $binmajor, $binminor)); } } } # echo the form with the values filled echo "<P><TEXTAREA class=maintextarea name=input rows=25 cols=25>" . $input . "</TEXTAREA></P>\n"; echo "<P>Major Name:</P>\n"; echo "<P><INPUT id=textbox1 name=majorname value=\"" . $majorname . "\"></P>\n"; echo "<P>Minor Name:</P>\n"; echo "<P><INPUT id=textbox1 name=minorname value=\"" . $minorname . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Create name=operation>\n"; echo "</DIV>\n"; echo "<P>Major Key:</P>\n"; echo "<P><INPUT id=textbox1 name=majorkey value=\"" . $majorkey . "\"></P>\n"; echo "<P>Minor Key:</P>\n"; echo "<P><INPUT id=textbox1 name=minorkey value=\"" . $minorkey . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Encrypt name=operation> \n"; echo "<INPUT class=submit type=submit value=Decrypt name=operation> </DIV>\n"; echo "<P>Result:</P>\n"; echo "<P><TEXTAREA class=maintextarea name=output rows=25 readOnly cols=25>" . $output . "</TEXTAREA></P></DIV></FORM>\n"; ?> What should be editted for better memory efficiency or faster execution?

    Read the article

  • Can this PHP version of SPICE be improved?

    - by Noctis Skytower
    I do not know much about PHP's standard library of functions and was wondering if the following code can be improved in any way. The implementation should yield the same results, the API should remain as it is, but ways to make is more PHP-ish would be greatly appreciated. This is a custom encryption library. Code <?php /*************************************** Create random major and minor SPICE key. ***************************************/ function crypt_major() { $all = range("\x00", "\xFF"); shuffle($all); $major_key = implode("", $all); return $major_key; } function crypt_minor() { $sample = array(); do { array_push($sample, 0, 1, 2, 3); } while (count($sample) != 256); shuffle($sample); $list = array(); for ($index = 0; $index < 64; $index++) { $b12 = $sample[$index * 4] << 6; $b34 = $sample[$index * 4 + 1] << 4; $b56 = $sample[$index * 4 + 2] << 2; $b78 = $sample[$index * 4 + 3]; array_push($list, $b12 + $b34 + $b56 + $b78); } $minor_key = implode("", array_map("chr", $list)); return $minor_key; } /*************************************** Create the SPICE key via the given name. ***************************************/ function named_major($name) { srand(crc32($name)); return crypt_major(); } function named_minor($name) { srand(crc32($name)); return crypt_minor(); } /*************************************** Check validity for major and minor keys. ***************************************/ function _check_major($key) { if (is_string($key) && strlen($key) == 256) { foreach (range("\x00", "\xFF") as $char) { if (substr_count($key, $char) == 0) { return FALSE; } } return TRUE; } return FALSE; } function _check_minor($key) { if (is_string($key) && strlen($key) == 64) { $indexs = array(); foreach (array_map("ord", str_split($key)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($indexs, ($byte >> $shift) & 3); } } $dict = array_count_values($indexs); foreach (range(0, 3) as $index) { if ($dict[$index] != 64) { return FALSE; } } return TRUE; } return FALSE; } /*************************************** Create encode maps for encode functions. ***************************************/ function _encode_map_1($major) { return array_map("ord", str_split($major)); } function _encode_map_2($minor) { $map_2 = array(array(), array(), array(), array()); $list = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($list, ($byte >> $shift) & 3); } } for ($byte = 0; $byte < 256; $byte++) { array_push($map_2[$list[$byte]], chr($byte)); } return $map_2; } /*************************************** Create decode maps for decode functions. ***************************************/ function _decode_map_1($minor) { $map_1 = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($map_1, ($byte >> $shift) & 3); } } return $map_1; }function _decode_map_2($major) { $map_2 = array(); $temp = array_map("ord", str_split($major)); for ($byte = 0; $byte < 256; $byte++) { $map_2[$temp[$byte]] = chr($byte); } return $map_2; } /*************************************** Encrypt or decrypt the string with maps. ***************************************/ function _encode($string, $map_1, $map_2) { $cache = ""; foreach (str_split($string) as $char) { $byte = $map_1[ord($char)]; foreach (range(6, 0, 2) as $shift) { $cache .= $map_2[($byte >> $shift) & 3][mt_rand(0, 63)]; } } return $cache; } function _decode($string, $map_1, $map_2) { $cache = ""; $temp = str_split($string); for ($iter = 0; $iter < strlen($string) / 4; $iter++) { $b12 = $map_1[ord($temp[$iter * 4])] << 6; $b34 = $map_1[ord($temp[$iter * 4 + 1])] << 4; $b56 = $map_1[ord($temp[$iter * 4 + 2])] << 2; $b78 = $map_1[ord($temp[$iter * 4 + 3])]; $cache .= $map_2[$b12 + $b34 + $b56 + $b78]; } return $cache; } /*************************************** This is the public interface for coding. ***************************************/ function encode_string($string, $major, $minor) { if (is_string($string)) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _encode_map_1($major); $map_2 = _encode_map_2($minor); return _encode($string, $map_1, $map_2); } } return FALSE; } function decode_string($string, $major, $minor) { if (is_string($string) && strlen($string) % 4 == 0) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _decode_map_1($minor); $map_2 = _decode_map_2($major); return _decode($string, $map_1, $map_2); } } return FALSE; } ?> This is a sample showing how the code is being used. Hex editors may be of help with the input / output. Example <?php # get and process all of the form data @ $input = htmlspecialchars($_POST["input"]); @ $majorname = htmlspecialchars($_POST["majorname"]); @ $minorname = htmlspecialchars($_POST["minorname"]); @ $majorkey = htmlspecialchars($_POST["majorkey"]); @ $minorkey = htmlspecialchars($_POST["minorkey"]); @ $output = htmlspecialchars($_POST["output"]); # process the submissions by operation # CREATE @ $operation = $_POST["operation"]; if ($operation == "Create") { if (strlen($_POST["majorname"]) == 0) { $majorkey = bin2hex(crypt_major()); } if (strlen($_POST["minorname"]) == 0) { $minorkey = bin2hex(crypt_minor()); } if (strlen($_POST["majorname"]) != 0) { $majorkey = bin2hex(named_major($_POST["majorname"])); } if (strlen($_POST["minorname"]) != 0) { $minorkey = bin2hex(named_minor($_POST["minorname"])); } } # ENCRYPT or DECRYPT function is_hex($char) { if ($char == "0"): return TRUE; elseif ($char == "1"): return TRUE; elseif ($char == "2"): return TRUE; elseif ($char == "3"): return TRUE; elseif ($char == "4"): return TRUE; elseif ($char == "5"): return TRUE; elseif ($char == "6"): return TRUE; elseif ($char == "7"): return TRUE; elseif ($char == "8"): return TRUE; elseif ($char == "9"): return TRUE; elseif ($char == "a"): return TRUE; elseif ($char == "b"): return TRUE; elseif ($char == "c"): return TRUE; elseif ($char == "d"): return TRUE; elseif ($char == "e"): return TRUE; elseif ($char == "f"): return TRUE; else: return FALSE; endif; } function hex2bin($str) { if (strlen($str) % 2 == 0): $string = strtolower($str); else: $string = strtolower("0" . $str); endif; $cache = ""; $temp = str_split($str); for ($index = 0; $index < count($temp) / 2; $index++) { $h1 = $temp[$index * 2]; if (is_hex($h1)) { $h2 = $temp[$index * 2 + 1]; if (is_hex($h2)) { $cache .= chr(hexdec($h1 . $h2)); } else { return FALSE; } } else { return FALSE; } } return $cache; } if ($operation == "Encrypt" || $operation == "Decrypt") { # CHECK FOR ANY ERROR $errors = array(); if (strlen($_POST["input"]) == 0) { $output = ""; } $binmajor = hex2bin($_POST["majorkey"]); if (strlen($_POST["majorkey"]) == 0) { array_push($errors, "There must be a major key."); } elseif ($binmajor == FALSE) { array_push($errors, "The major key must be in hex."); } elseif (_check_major($binmajor) == FALSE) { array_push($errors, "The major key is corrupt."); } $binminor = hex2bin($_POST["minorkey"]); if (strlen($_POST["minorkey"]) == 0) { array_push($errors, "There must be a minor key."); } elseif ($binminor == FALSE) { array_push($errors, "The minor key must be in hex."); } elseif (_check_minor($binminor) == FALSE) { array_push($errors, "The minor key is corrupt."); } if ($_POST["operation"] == "Decrypt") { $bininput = hex2bin(str_replace("\r", "", str_replace("\n", "", $_POST["input"]))); if ($bininput == FALSE) { if (strlen($_POST["input"]) != 0) { array_push($errors, "The input data must be in hex."); } } elseif (strlen($bininput) % 4 != 0) { array_push($errors, "The input data is corrupt."); } } if (count($errors) != 0) { # ERRORS ARE FOUND $output = "ERROR:"; foreach ($errors as $error) { $output .= "\n" . $error; } } elseif (strlen($_POST["input"]) != 0) { # CONTINUE WORKING if ($_POST["operation"] == "Encrypt") { # ENCRYPT $output = substr(chunk_split(bin2hex(encode_string($_POST["input"], $binmajor, $binminor)), 58), 0, -2); } else { # DECRYPT $output = htmlspecialchars(decode_string($bininput, $binmajor, $binminor)); } } } # echo the form with the values filled echo "<P><TEXTAREA class=maintextarea name=input rows=25 cols=25>" . $input . "</TEXTAREA></P>\n"; echo "<P>Major Name:</P>\n"; echo "<P><INPUT id=textbox1 name=majorname value=\"" . $majorname . "\"></P>\n"; echo "<P>Minor Name:</P>\n"; echo "<P><INPUT id=textbox1 name=minorname value=\"" . $minorname . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Create name=operation>\n"; echo "</DIV>\n"; echo "<P>Major Key:</P>\n"; echo "<P><INPUT id=textbox1 name=majorkey value=\"" . $majorkey . "\"></P>\n"; echo "<P>Minor Key:</P>\n"; echo "<P><INPUT id=textbox1 name=minorkey value=\"" . $minorkey . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Encrypt name=operation> \n"; echo "<INPUT class=submit type=submit value=Decrypt name=operation> </DIV>\n"; echo "<P>Result:</P>\n"; echo "<P><TEXTAREA class=maintextarea name=output rows=25 readOnly cols=25>" . $output . "</TEXTAREA></P></DIV></FORM>\n"; ?>

    Read the article

  • What can be improved in this PHP code?

    - by Noctis Skytower
    This is a custom encryption library. I do not know much about PHP's standard library of functions and was wondering if the following code can be improved in any way. The implementation should yield the same results, the API should remain as it is, but ways to make is more PHP-ish would be greatly appreciated. Code <?php /*************************************** Create random major and minor SPICE key. ***************************************/ function crypt_major() { $all = range("\x00", "\xFF"); shuffle($all); $major_key = implode("", $all); return $major_key; } function crypt_minor() { $sample = array(); do { array_push($sample, 0, 1, 2, 3); } while (count($sample) != 256); shuffle($sample); $list = array(); for ($index = 0; $index < 64; $index++) { $b12 = $sample[$index * 4] << 6; $b34 = $sample[$index * 4 + 1] << 4; $b56 = $sample[$index * 4 + 2] << 2; $b78 = $sample[$index * 4 + 3]; array_push($list, $b12 + $b34 + $b56 + $b78); } $minor_key = implode("", array_map("chr", $list)); return $minor_key; } /*************************************** Create the SPICE key via the given name. ***************************************/ function named_major($name) { srand(crc32($name)); return crypt_major(); } function named_minor($name) { srand(crc32($name)); return crypt_minor(); } /*************************************** Check validity for major and minor keys. ***************************************/ function _check_major($key) { if (is_string($key) && strlen($key) == 256) { foreach (range("\x00", "\xFF") as $char) { if (substr_count($key, $char) == 0) { return FALSE; } } return TRUE; } return FALSE; } function _check_minor($key) { if (is_string($key) && strlen($key) == 64) { $indexs = array(); foreach (array_map("ord", str_split($key)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($indexs, ($byte >> $shift) & 3); } } $dict = array_count_values($indexs); foreach (range(0, 3) as $index) { if ($dict[$index] != 64) { return FALSE; } } return TRUE; } return FALSE; } /*************************************** Create encode maps for encode functions. ***************************************/ function _encode_map_1($major) { return array_map("ord", str_split($major)); } function _encode_map_2($minor) { $map_2 = array(array(), array(), array(), array()); $list = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($list, ($byte >> $shift) & 3); } } for ($byte = 0; $byte < 256; $byte++) { array_push($map_2[$list[$byte]], chr($byte)); } return $map_2; } /*************************************** Create decode maps for decode functions. ***************************************/ function _decode_map_1($minor) { $map_1 = array(); foreach (array_map("ord", str_split($minor)) as $byte) { foreach (range(6, 0, 2) as $shift) { array_push($map_1, ($byte >> $shift) & 3); } } return $map_1; }function _decode_map_2($major) { $map_2 = array(); $temp = array_map("ord", str_split($major)); for ($byte = 0; $byte < 256; $byte++) { $map_2[$temp[$byte]] = chr($byte); } return $map_2; } /*************************************** Encrypt or decrypt the string with maps. ***************************************/ function _encode($string, $map_1, $map_2) { $cache = ""; foreach (str_split($string) as $char) { $byte = $map_1[ord($char)]; foreach (range(6, 0, 2) as $shift) { $cache .= $map_2[($byte >> $shift) & 3][mt_rand(0, 63)]; } } return $cache; } function _decode($string, $map_1, $map_2) { $cache = ""; $temp = str_split($string); for ($iter = 0; $iter < strlen($string) / 4; $iter++) { $b12 = $map_1[ord($temp[$iter * 4])] << 6; $b34 = $map_1[ord($temp[$iter * 4 + 1])] << 4; $b56 = $map_1[ord($temp[$iter * 4 + 2])] << 2; $b78 = $map_1[ord($temp[$iter * 4 + 3])]; $cache .= $map_2[$b12 + $b34 + $b56 + $b78]; } return $cache; } /*************************************** This is the public interface for coding. ***************************************/ function encode_string($string, $major, $minor) { if (is_string($string)) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _encode_map_1($major); $map_2 = _encode_map_2($minor); return _encode($string, $map_1, $map_2); } } return FALSE; } function decode_string($string, $major, $minor) { if (is_string($string) && strlen($string) % 4 == 0) { if (_check_major($major) && _check_minor($minor)) { $map_1 = _decode_map_1($minor); $map_2 = _decode_map_2($major); return _decode($string, $map_1, $map_2); } } return FALSE; } ?> This is a sample showing how the code is being used. Hex editors may be of help with the input / output. Example <?php # get and process all of the form data @ $input = htmlspecialchars($_POST["input"]); @ $majorname = htmlspecialchars($_POST["majorname"]); @ $minorname = htmlspecialchars($_POST["minorname"]); @ $majorkey = htmlspecialchars($_POST["majorkey"]); @ $minorkey = htmlspecialchars($_POST["minorkey"]); @ $output = htmlspecialchars($_POST["output"]); # process the submissions by operation # CREATE @ $operation = $_POST["operation"]; if ($operation == "Create") { if (strlen($_POST["majorname"]) == 0) { $majorkey = bin2hex(crypt_major()); } if (strlen($_POST["minorname"]) == 0) { $minorkey = bin2hex(crypt_minor()); } if (strlen($_POST["majorname"]) != 0) { $majorkey = bin2hex(named_major($_POST["majorname"])); } if (strlen($_POST["minorname"]) != 0) { $minorkey = bin2hex(named_minor($_POST["minorname"])); } } # ENCRYPT or DECRYPT function is_hex($char) { if ($char == "0"): return TRUE; elseif ($char == "1"): return TRUE; elseif ($char == "2"): return TRUE; elseif ($char == "3"): return TRUE; elseif ($char == "4"): return TRUE; elseif ($char == "5"): return TRUE; elseif ($char == "6"): return TRUE; elseif ($char == "7"): return TRUE; elseif ($char == "8"): return TRUE; elseif ($char == "9"): return TRUE; elseif ($char == "a"): return TRUE; elseif ($char == "b"): return TRUE; elseif ($char == "c"): return TRUE; elseif ($char == "d"): return TRUE; elseif ($char == "e"): return TRUE; elseif ($char == "f"): return TRUE; else: return FALSE; endif; } function hex2bin($str) { if (strlen($str) % 2 == 0): $string = strtolower($str); else: $string = strtolower("0" . $str); endif; $cache = ""; $temp = str_split($str); for ($index = 0; $index < count($temp) / 2; $index++) { $h1 = $temp[$index * 2]; if (is_hex($h1)) { $h2 = $temp[$index * 2 + 1]; if (is_hex($h2)) { $cache .= chr(hexdec($h1 . $h2)); } else { return FALSE; } } else { return FALSE; } } return $cache; } if ($operation == "Encrypt" || $operation == "Decrypt") { # CHECK FOR ANY ERROR $errors = array(); if (strlen($_POST["input"]) == 0) { $output = ""; } $binmajor = hex2bin($_POST["majorkey"]); if (strlen($_POST["majorkey"]) == 0) { array_push($errors, "There must be a major key."); } elseif ($binmajor == FALSE) { array_push($errors, "The major key must be in hex."); } elseif (_check_major($binmajor) == FALSE) { array_push($errors, "The major key is corrupt."); } $binminor = hex2bin($_POST["minorkey"]); if (strlen($_POST["minorkey"]) == 0) { array_push($errors, "There must be a minor key."); } elseif ($binminor == FALSE) { array_push($errors, "The minor key must be in hex."); } elseif (_check_minor($binminor) == FALSE) { array_push($errors, "The minor key is corrupt."); } if ($_POST["operation"] == "Decrypt") { $bininput = hex2bin(str_replace("\r", "", str_replace("\n", "", $_POST["input"]))); if ($bininput == FALSE) { if (strlen($_POST["input"]) != 0) { array_push($errors, "The input data must be in hex."); } } elseif (strlen($bininput) % 4 != 0) { array_push($errors, "The input data is corrupt."); } } if (count($errors) != 0) { # ERRORS ARE FOUND $output = "ERROR:"; foreach ($errors as $error) { $output .= "\n" . $error; } } elseif (strlen($_POST["input"]) != 0) { # CONTINUE WORKING if ($_POST["operation"] == "Encrypt") { # ENCRYPT $output = substr(chunk_split(bin2hex(encode_string($_POST["input"], $binmajor, $binminor)), 58), 0, -2); } else { # DECRYPT $output = htmlspecialchars(decode_string($bininput, $binmajor, $binminor)); } } } # echo the form with the values filled echo "<P><TEXTAREA class=maintextarea name=input rows=25 cols=25>" . $input . "</TEXTAREA></P>\n"; echo "<P>Major Name:</P>\n"; echo "<P><INPUT id=textbox1 name=majorname value=\"" . $majorname . "\"></P>\n"; echo "<P>Minor Name:</P>\n"; echo "<P><INPUT id=textbox1 name=minorname value=\"" . $minorname . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Create name=operation>\n"; echo "</DIV>\n"; echo "<P>Major Key:</P>\n"; echo "<P><INPUT id=textbox1 name=majorkey value=\"" . $majorkey . "\"></P>\n"; echo "<P>Minor Key:</P>\n"; echo "<P><INPUT id=textbox1 name=minorkey value=\"" . $minorkey . "\"></P>\n"; echo "<DIV style=\"TEXT-ALIGN: center\"><INPUT class=submit type=submit value=Encrypt name=operation> \n"; echo "<INPUT class=submit type=submit value=Decrypt name=operation> </DIV>\n"; echo "<P>Result:</P>\n"; echo "<P><TEXTAREA class=maintextarea name=output rows=25 readOnly cols=25>" . $output . "</TEXTAREA></P></DIV></FORM>\n"; ?> What should be editted for better memory efficiency or faster execution?

    Read the article

  • How to maintain encapsulation with composition in C++?

    - by iFreilicht
    I am designing a class Master that is composed from multiple other classes, A, Base, C and D. These four classes have absolutely no use outside of Master and are meant to split up its functionality into manageable and logically divided packages. They also provide extensible functionality as in the case of Base, which can be inherited from by clients. But, how do I maintain encapsulation of Master with this design? So far, I've got two approaches, which are both far from perfect: 1. Replicate all accessors: Just write accessor-methods for all accessor-methods of all classes that Master is composed of. This leads to perfect encapsulation, because no implementation detail of Master is visible, but is extremely tedious and makes the class definition monstrous, which is exactly what the composition should prevent. Also, adding functionality to one of the composees (is that even a word?) would require to re-write all those methods in Master. An additional problem is that inheritors of Base could only alter, but not add functionality. 2. Use non-assignable, non-copyable member-accessors: Having a class accessor<T> that can not be copied, moved or assigned to, but overrides the operator-> to access an underlying shared_ptr, so that calls like Master->A()->niceFunction(); are made possible. My problem with this is that it kind of breaks encapsulation as I would now be unable to change my implementation of Master to use a different class for the functionality of niceFunction(). Still, it is the closest I've gotten without using the ugly first approach. It also fixes the inheritance issue quite nicely. A small side question would be if such a class already existed in std or boost. EDIT: Wall of code I will now post the code of the header files of the classes discussed. It may be a bit hard to understand, but I'll give my best in explaining all of it. 1. GameTree.h The foundation of it all. This basically is a doubly-linked tree, holding GameObject-instances, which we'll later get to. It also has it's own custom iterator GTIterator, but I left that out for brevity. WResult is an enum with the values SUCCESS and FAILED, but it's not really important. class GameTree { public: //Static methods for the root. Only one root is allowed to exist at a time! static void ConstructRoot(seed_type seed, unsigned int depth); inline static bool rootExists(){ return static_cast<bool>(rootObject_); } inline static weak_ptr<GameTree> root(){ return rootObject_; } //delta is in ms, this is used for velocity, collision and such void tick(unsigned int delta); //Interaction with the tree inline weak_ptr<GameTree> parent() const { return parent_; } inline unsigned int numChildren() const{ return static_cast<unsigned int>(children_.size()); } weak_ptr<GameTree> getChild(unsigned int index) const; template<typename GOType> weak_ptr<GameTree> addChild(seed_type seed, unsigned int depth = 9001){ GOType object{ new GOType(seed) }; return addChildObject(unique_ptr<GameTree>(new GameTree(std::move(object), depth))); } WResult moveTo(weak_ptr<GameTree> newParent); WResult erase(); //Iterators for for( : ) loop GTIterator& begin(){ return *(beginIter_ = std::move(make_unique<GTIterator>(children_.begin()))); } GTIterator& end(){ return *(endIter_ = std::move(make_unique<GTIterator>(children_.end()))); } //unloading should be used when objects are far away WResult unloadChildren(unsigned int newDepth = 0); WResult loadChildren(unsigned int newDepth = 1); inline const RenderObject& renderObject() const{ return gameObject_->renderObject(); } //Getter for the underlying GameObject (I have not tested the template version) weak_ptr<GameObject> gameObject(){ return gameObject_; } template<typename GOType> weak_ptr<GOType> gameObject(){ return dynamic_cast<weak_ptr<GOType>>(gameObject_); } weak_ptr<PhysicsObject> physicsObject() { return gameObject_->physicsObject(); } private: GameTree(const GameTree&); //copying is only allowed internally GameTree(shared_ptr<GameObject> object, unsigned int depth = 9001); //pointer to root static shared_ptr<GameTree> rootObject_; //internal management of a child weak_ptr<GameTree> addChildObject(shared_ptr<GameTree>); WResult removeChild(unsigned int index); //private members shared_ptr<GameObject> gameObject_; shared_ptr<GTIterator> beginIter_; shared_ptr<GTIterator> endIter_; //tree stuff vector<shared_ptr<GameTree>> children_; weak_ptr<GameTree> parent_; unsigned int selfIndex_; //used for deletion, this isn't necessary void initChildren(unsigned int depth); //constructs children }; 2. GameObject.h This is a bit hard to grasp, but GameObject basically works like this: When constructing a GameObject, you construct its basic attributes and a CResult-instance, which contains a vector<unique_ptr<Construction>>. The Construction-struct contains all information that is needed to construct a GameObject, which is a seed and a function-object that is applied at construction by a factory. This enables dynamic loading and unloading of GameObjects as done by GameTree. It also means that you have to define that factory if you inherit GameObject. This inheritance is also the reason why GameTree has a template-function gameObject<GOType>. GameObject can contain a RenderObject and a PhysicsObject, which we'll later get to. Anyway, here's the code. class GameObject; typedef unsigned long seed_type; //this declaration magic means that all GameObjectFactorys inherit from GameObjectFactory<GameObject> template<typename GOType> struct GameObjectFactory; template<> struct GameObjectFactory<GameObject>{ virtual unique_ptr<GameObject> construct(seed_type seed) const = 0; }; template<typename GOType> struct GameObjectFactory : GameObjectFactory<GameObject>{ GameObjectFactory() : GameObjectFactory<GameObject>(){} unique_ptr<GameObject> construct(seed_type seed) const{ return unique_ptr<GOType>(new GOType(seed)); } }; //same as with the factories. this is important for storing them in vectors template<typename GOType> struct Construction; template<> struct Construction<GameObject>{ virtual unique_ptr<GameObject> construct() const = 0; }; template<typename GOType> struct Construction : Construction<GameObject>{ Construction(seed_type seed, function<void(GOType*)> func = [](GOType* null){}) : Construction<GameObject>(), seed_(seed), func_(func) {} unique_ptr<GameObject> construct() const{ unique_ptr<GameObject> gameObject{ GOType::factory.construct(seed_) }; func_(dynamic_cast<GOType*>(gameObject.get())); return std::move(gameObject); } seed_type seed_; function<void(GOType*)> func_; }; typedef struct CResult { CResult() : constructions{} {} CResult(CResult && o) : constructions(std::move(o.constructions)) {} CResult& operator= (CResult& other){ if (this != &other){ for (unique_ptr<Construction<GameObject>>& child : other.constructions){ constructions.push_back(std::move(child)); } } return *this; } template<typename GOType> void push_back(seed_type seed, function<void(GOType*)> func = [](GOType* null){}){ constructions.push_back(make_unique<Construction<GOType>>(seed, func)); } vector<unique_ptr<Construction<GameObject>>> constructions; } CResult; //finally, the GameObject class GameObject { public: GameObject(seed_type seed); GameObject(const GameObject&); virtual void tick(unsigned int delta); inline Matrix4f trafoMatrix(){ return physicsObject_->transformationMatrix(); } //getter inline seed_type seed() const{ return seed_; } inline CResult& properties(){ return properties_; } inline const RenderObject& renderObject() const{ return *renderObject_; } inline weak_ptr<PhysicsObject> physicsObject() { return physicsObject_; } protected: virtual CResult construct_(seed_type seed) = 0; CResult properties_; shared_ptr<RenderObject> renderObject_; shared_ptr<PhysicsObject> physicsObject_; seed_type seed_; }; 3. PhysicsObject That's a bit easier. It is responsible for position, velocity and acceleration. It will also handle collisions in the future. It contains three Transformation objects, two of which are optional. I'm not going to include the accessors on the PhysicsObject class because I tried my first approach on it and it's just pure madness (way over 30 functions). Also missing: the named constructors that construct PhysicsObjects with different behaviour. class Transformation{ Vector3f translation_; Vector3f rotation_; Vector3f scaling_; public: Transformation() : translation_{ 0, 0, 0 }, rotation_{ 0, 0, 0 }, scaling_{ 1, 1, 1 } {}; Transformation(Vector3f translation, Vector3f rotation, Vector3f scaling); inline Vector3f translation(){ return translation_; } inline void translation(float x, float y, float z){ translation(Vector3f(x, y, z)); } inline void translation(Vector3f newTranslation){ translation_ = newTranslation; } inline void translate(float x, float y, float z){ translate(Vector3f(x, y, z)); } inline void translate(Vector3f summand){ translation_ += summand; } inline Vector3f rotation(){ return rotation_; } inline void rotation(float pitch, float yaw, float roll){ rotation(Vector3f(pitch, yaw, roll)); } inline void rotation(Vector3f newRotation){ rotation_ = newRotation; } inline void rotate(float pitch, float yaw, float roll){ rotate(Vector3f(pitch, yaw, roll)); } inline void rotate(Vector3f summand){ rotation_ += summand; } inline Vector3f scaling(){ return scaling_; } inline void scaling(float x, float y, float z){ scaling(Vector3f(x, y, z)); } inline void scaling(Vector3f newScaling){ scaling_ = newScaling; } inline void scale(float x, float y, float z){ scale(Vector3f(x, y, z)); } void scale(Vector3f factor){ scaling_(0) *= factor(0); scaling_(1) *= factor(1); scaling_(2) *= factor(2); } Matrix4f matrix(){ return WMatrix::Translation(translation_) * WMatrix::Rotation(rotation_) * WMatrix::Scale(scaling_); } }; class PhysicsObject; typedef void tickFunction(PhysicsObject& self, unsigned int delta); class PhysicsObject{ PhysicsObject(const Transformation& trafo) : transformation_(trafo), transformationVelocity_(nullptr), transformationAcceleration_(nullptr), tick_(nullptr) {} PhysicsObject(PhysicsObject&& other) : transformation_(other.transformation_), transformationVelocity_(std::move(other.transformationVelocity_)), transformationAcceleration_(std::move(other.transformationAcceleration_)), tick_(other.tick_) {} Transformation transformation_; unique_ptr<Transformation> transformationVelocity_; unique_ptr<Transformation> transformationAcceleration_; tickFunction* tick_; public: void tick(unsigned int delta){ tick_ ? tick_(*this, delta) : 0; } inline Matrix4f transformationMatrix(){ return transformation_.matrix(); } } 4. RenderObject RenderObject is a base class for different types of things that could be rendered, i.e. Meshes, Light Sources or Sprites. DISCLAIMER: I did not write this code, I'm working on this project with someone else. class RenderObject { public: RenderObject(float renderDistance); virtual ~RenderObject(); float renderDistance() const { return renderDistance_; } void setRenderDistance(float rD) { renderDistance_ = rD; } protected: float renderDistance_; }; struct NullRenderObject : public RenderObject{ NullRenderObject() : RenderObject(0.f){}; }; class Light : public RenderObject{ public: Light() : RenderObject(30.f){}; }; class Mesh : public RenderObject{ public: Mesh(unsigned int seed) : RenderObject(20.f) { meshID_ = 0; textureID_ = 0; if (seed == 1) meshID_ = Model::getMeshID("EM-208_heavy"); else meshID_ = Model::getMeshID("cube"); }; unsigned int getMeshID() const { return meshID_; } unsigned int getTextureID() const { return textureID_; } private: unsigned int meshID_; unsigned int textureID_; }; I guess this shows my issue quite nicely: You see a few accessors in GameObject which return weak_ptrs to access members of members, but that is not really what I want. Also please keep in mind that this is NOT, by any means, finished or production code! It is merely a prototype and there may be inconsistencies, unnecessary public parts of classes and such.

    Read the article

  • Why am I getting an error when return TRUE/FALSE to type Boolean?

    - by phill
    I wrote the following code: import java.lang.*; import DB.*; private Boolean validateInvoice(String i) { int count = 0; try { //check how many rowsets ResultSet c = connection.DBquery("select count(*) from Invce i,cust c where tranid like '"+i+"' and i.key = c.key "); while (c.next()) { System.out.println("rowcount : " + c.getInt(1)); count = c.getInt(1); } if (count > 0 ) { return TRUE; } else { return FALSE; } //end if } catch(Exception e){e.printStackTrace();return FALSE;} } The errors I'm getting are: i.java:195: cannot find symbol symbol : variable TRUE location: class changei.iTable return TRUE; i.java:197: cannot find symbol symbol : variable TRUE location: class changei.iTable return FALSE; i.java:201:: cannot find symbol symbol : variable FALSE location: class changei.iTable catch(Exception e){e.printStackTrace();return FALSE;} The Connection class comes from the DB package i created. Is the return TRUE/FALSE correct since the function is a Boolean return type?

    Read the article

  • Fix: Orchard Error ‘The controller for path '/OrchardLocal/' was not found or does not implement IController.

    - by Ken Cox [MVP]
    Suddenly, in a local Orchard 1.6 project, I started getting this error in ShellRoute.cs: The controller for path '/OrchardLocal/' was not found or does not implement IController. Obviously I had changed something, but the error wasn’t helping much.  After losing far too much time, I copied over the original Orchard source code and was back in business. Shortly thereafter, I further flattened my forehead by applying a sudden, solid blow with the lower portion of my palm! You see, in testing the importing of comments via blogML, I had set the added blog as the Orchard site’s Start page. Then, I deleted the blog so I could test another import batch. The upshot was that by deleting the blog, Orchard no longer had a default (home) page at the root of the site. The site’s default content was missing. The fix was to go to the Admin subdirectory (http://localhost:30320/OrchardLocal/admin) . add a new page, and check Set as homepage. Once again, the problem was between the keyboard and the chair. I hope this helps someone else. Ken

    Read the article

  • Is this right in the use case of exec method of child_process? is there away to cody the envirorment along with the require module too?

    - by L2L2L
    I'm learning node. I am using child_process to move data to another script to be executed. But it seem that it does not copy the hold environment or I could be doing something wrong. To copy the hold environment --require modules too-- or is this when I use spawn, I'm not so clear or understanding spawn exec and execfile --although execfile is like what I'm doing at the bottom, but with exec... right?-- And I would just love to have some clarity on this matter. Please anyone? Thank you. parent.js - "use strict"; var fs, path, _err; fs = require("fs"), path = require("path"), _err = require("./err.js"); var url; url= process.argv[1]; var dirname, locate_r; dirname = path.dirname(url); locate_r = dirname + "/" + "test.json";//path.join(dirname,"/", "test.json"); var flag, str; flag = "r", str = ""; fs.open(locate_r, flag, function opd(error, fd){ if (error){_err(error, function(){ fs.close(fd,function(){ process.stderr.write("\n" + "In Finally Block: File Closed!" + "\n");});})} var readBuff, buffOffset, buffLength, filePos; readBuff = new Buffer(15), buffOffset = 0, buffLength = readBuff.length, filePos = 0; fs.read(fd, readBuff, buffOffset, buffLength, filePos, function rd(error, readBytes){ error&&_err(error, fd); str = readBuff.toString("utf8"); process.env.str = str; process.stdout.write("str: "+ str + "\n" + "readBuff: " + readBuff + "\n"); fs.close(fd, function(){process.stdout.write( "Read and Closed File." + "\n" )}); //write(str); //run test for process.exec** var env, varName, envCopy, exec; env = process.env, varName, envCopy = {}, exec = require("child_process").exec; for(varName in env){ envCopy[varName] = env[varName]; } process.env.fs = fs, process.env.path = path, process.env.dirname = dirname, process.env.flag = flag, process.env.str = str, process.env._err = _err; process.env.fd = fd; exec("node child.js", env, function(error, stdout, stderr){ if(error){throw (new Error(error));} }); }); }); child.js - "use strict"; var fs, path, _err; fs = require("fs"), path = require("path"), _err = require("./err.js"); var fd, fs, flag, path, dirname, str, _err; fd = process.env.fd, //fs = process.env.fs, //path = process.env.path, dirname = process.env.dirname, flag = process.env.flag, str = process.env.str, _err = process.env._err; var url; url= process.argv[1]; var locate_r; dirname = path.dirname(url); locate_r = dirname + "/" + "test.json";//path.join(dirname,"/", "test.json"); //function write(str){ var locate_a; locate_a = dirname + "/" + "test.json"; //path.join(dirname,"/", "test.json"); flag = "a"; fs.open(locate_a, flag, function opd(error, fd){ error&&_err(error, fs, fd); var writeBuff, buffPos, buffLgh, filePs; writeBuff = new Buffer(str), process.stdout.write( "writeBuff: " + writeBuff + "\n" + "str: " + str + "\n"), buffPos = 0, buffLgh = writeBuff.length, filePs = buffLgh;//null; fs.write(fd, writeBuff, buffPos, buffLgh, filePs-3, function(error, written){ error&&_err(error, function(){ fs.close(fd,function(){ process.stderr.write("\n" + "In Finally Block: File Closed!" + "\n"); }); }); fs.close(fd, function(){process.stdout.write( "Written and Closed File." + "\n");}); }); }); //} err.js - "use strict"; var fs; fs = require("fs"); module.exports = function _err(err, scp, cd){ try{ throw (new Error(err)); }catch(e){ process.stderr.write(e + "\n"); }finally{ cd; } }

    Read the article

  • What happens to C# 4 optional parameters when compiling against 3.5?

    - by Bertrand Le Roy
    Here’s a method declaration that uses optional parameters: public Path Copy( Path destination, bool overwrite = false, bool recursive = false) Something you may not know is that Visual Studio 2010 will let you compile this against .NET 3.5, with no error or warning. You may be wondering (as I was) how it does that. Well, it takes the easy and rather obvious way of not trying to be too smart and just ignores the optional parameters. So if you’re compiling against 3.5 from Visual Studio 2010, the above code is equivalent to: public Path Copy( Path destination, bool overwrite, bool recursive) The parameters are not optional (no such thing in C# 3), and no overload gets magically created for you. If you’re building a library that is going to have both 3.5 and 4.0 versions, and you want 3.5 users to have reasonable overloads of your methods, you’ll have to provide those yourself, which means that providing a version with optional parameters for the benefit of 4.0 users is not going to provide that much value, except for the ability to provide named parameters out of order. I guess that’s not so bad… Providing all of the following overloads will compile against both 3.5 and 4.0: public Path Copy(Path destination)public Path Copy(Path destination, bool overwrite)public Path Copy( Path destination, bool overwrite = false, bool recursive = false)

    Read the article

  • Using Diskpart in a PowerShell script won't allow script to reuse drive letter

    - by Kyle
    I built a script that mounts (attach) a VHD using Diskpart, cleans out some system files and then unmounts (detach) it. It uses a foreach loop and is suppose to clean multiple VHD using the same drive letter. However, after the 1st VHD it fails. I also noticed that when I try to manually attach a VHD with diskpart, diskpart succeeds, the Disk Manager shows the disk with the correct drive letter, but within the same PoSH instance I can not connect (set-location) to that drive. If I do a manual diskpart when I 1st open PoSH I can attach and detach all I want and I get the drive letter every time. Is there something I need to do to reset diskpart in the script? Here's a snippet of the script I'm using. function Mount-VHD { [CmdletBinding()] param ( [Parameter(Position=0,Mandatory=$true,ValueFromPipeline=$false)] [string]$Path, [Parameter(Position=1,Mandatory=$false,ValueFromPipeline=$false)] [string]$DL, [string]$DiskpartScript = "$env:SystemDrive\DiskpartScript.txt", [switch]$Rescan ) begin { function InvokeDiskpart { Diskpart.exe /s $DiskpartScript } ## Validate Operating System Version ## if (Get-WmiObject win32_OperatingSystem -Filter "Version < '6.1'") {throw "The script operation requires at least Windows 7 or Windows Server 2008 R2."} } process{ ## Diskpart Script Content ## Here-String statement purposefully not indented ## @" $(if ($Rescan) {'Rescan'}) Select VDisk File="$Path" `nAttach VDisk Exit "@ | Out-File -FilePath $DiskpartScript -Encoding ASCII -Force InvokeDiskpart Start-Sleep -Seconds 3 @" Select VDisk File="$Path"`nSelect partition 1 `nAssign Letter="$DL" Exit "@ | Out-File -FilePath $DiskpartScript -Encoding ASCII -Force InvokeDiskpart } end { Remove-Item -Path $DiskpartScript -Force ; "" Write-Host "The VHD ""$Path"" has been successfully mounted." ; "" } } function Dismount-VHD { [CmdletBinding()] param ( [Parameter(Position=0,Mandatory=$true,ValueFromPipeline=$false)] [string]$Path, [switch]$Remove, [switch]$NoConfirm, [string]$DiskpartScript = "$env:SystemDrive\DiskpartScript.txt", [switch]$Rescan ) begin { function InvokeDiskpart { Diskpart.exe /s $DiskpartScript } function RemoveVHD { switch ($NoConfirm) { $false { ## Prompt for confirmation to delete the VHD file ## "" ; Write-Warning "Are you sure you want to delete the file ""$Path""?" $Prompt = Read-Host "Type ""YES"" to continue or anything else to break" if ($Prompt -ceq 'YES') { Remove-Item -Path $Path -Force "" ; Write-Host "VHD ""$Path"" deleted!" ; "" } else { "" ; Write-Host "Script terminated without deleting the VHD file." ; "" } } $true { ## Confirmation prompt suppressed ## Remove-Item -Path $Path -Force "" ; Write-Host "VHD ""$Path"" deleted!" ; "" } } } ## Validate Operating System Version ## if (Get-WmiObject win32_OperatingSystem -Filter "Version < '6.1'") {throw "The script operation requires at least Windows 7 or Windows Server 2008 R2."} } process{ ## DiskPart Script Content ## Here-String statement purposefully not indented ## @" $(if ($Rescan) {'Rescan'}) Select VDisk File="$Path"`nDetach VDisk Exit "@ | Out-File -FilePath $DiskpartScript -Encoding ASCII -Force InvokeDiskpart Start-Sleep -Seconds 10 } end { if ($Remove) {RemoveVHD} Remove-Item -Path $DiskpartScript -Force ; "" } }

    Read the article

  • Finding the XPath with the node name

    - by julien.schneider(at)oracle.com
    A function that i find missing is to get the Xpath expression of a node. For example, suppose i only know the node name <theNode>, i'd like to get its complete path /Where/is/theNode.   Using this rather simple Xquery you can easily get the path to your node. declare namespace orcl = "http://www.oracle.com/weblogic_soa_and_more"; declare function orcl:findXpath($path as element()*) as xs:string { if(local-name($path/..)='') then local-name($path) else concat(orcl:findXpath($path/..),'/',local-name($path)) }; declare function orcl:PathFinder($inputRecord as element(), $path as element()) as element(*) { { for $index in $inputRecord//*[local-name()=$path/text()] return orcl:findXpath($index) } }; declare variable $inputRecord as element() external; declare variable $path as element() external; orcl:PathFinder($inputRecord, $path)   With a path         <myNode>nodeName</myNode>  and a message         <node1><node2><nodeName>test</nodeName></node2></node1>  the result will be         node1/node2/nodeName   This is particularly useful when you use the Validate action of OSB because Validate only returns the xml node which is in error and not the full location itself. The following OSB project reuses this Xquery to reformat the result of the Validate Action. Just send an invalid xml like <myElem http://blogs.oracle.com/weblogic_soa_and_more"http://blogs.oracle.com/weblogic_soa_and_more">      <mySubElem>      </mySubElem></myElem>   you'll get as nice <MessageIsNotValid> <ErrorDetail  nbr="1"> <dataElementhPath>Body/myElem/mySubElem</dataElementhPath> <message> Expected element 'Subelem1@http://blogs.oracle.com/weblogic_soa_and_more' before the end of the content in element mySubElem@http://blogs.oracle.com/weblogic_soa_and_more </message> </ErrorDetail> </MessageIsNotValid>   Download the OSB project : sbconfig_xpath.jar   Enjoy.            

    Read the article

< Previous Page | 114 115 116 117 118 119 120 121 122 123 124 125  | Next Page >